C11H23N3O2 — CID 115605829
N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrrolidine-1-carboxamide (PubChem CID 115605829) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 115605829 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrrolidine-1-carboxamide |
| SMILES | COCCN(C)CCNC(=O)N1CCCC1 |
| InChI | InChI=1S/C11H23N3O2/c1-13(9-10-16-2)8-5-12-11(15)14-6-3-4-7-14/h3-10H2,1-2H3,(H,12,15) |
| InChIKey | ZDSLTMLBFWGXPN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |