C10H20N4O — CID 115606272
N-(3-morpholin-4-ylpropyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 115606272) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 115606272 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C(CNC1=NCCN1)CN1CCOCC1 |
| InChI | InChI=1S/C10H20N4O/c1(2-11-10-12-3-4-13-10)5-14-6-8-15-9-7-14/h1-9H2,(H2,11,12,13) |
| InChIKey | DRLXGSSKNYICAH-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|