C14H14F3NO — CID 115607292
3,3,3-trifluoro-N-(furan-3-ylmethyl)-1-phenylpropan-1-amine (PubChem CID 115607292) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(furan-3-ylmethyl)-1-phenylpropan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-(furan-3-ylmethyl)-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 115607292 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3,3,3-trifluoro-N-(furan-3-ylmethyl)-1-phenylpropan-1-amine |
| SMILES | FC(F)(F)CC(NCc1ccoc1)c1ccccc1 |
| InChI | InChI=1S/C14H14F3NO/c15-14(16,17)8-13(12-4-2-1-3-5-12)18-9-11-6-7-19-10-11/h1-7,10,13,18H,8-9H2 |
| InChIKey | PRVCQFODGNYREU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |