C13H18ClN3 — CID 115607475
N-(1H-indazol-6-ylmethyl)-1-(2-methylcyclopropyl)methanamine;hydrochloride (PubChem CID 115607475) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-(1H-indazol-6-ylmethyl)-1-(2-methylcyclopropyl)methanamine;hydrochloride.
| Compound Name | N-(1H-indazol-6-ylmethyl)-1-(2-methylcyclopropyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 115607475 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-(1H-indazol-6-ylmethyl)-1-(2-methylcyclopropyl)methanamine;hydrochloride |
| SMILES | CC1CC1CNCc1ccc2cn[nH]c2c1.Cl |
| InChI | InChI=1S/C13H17N3.ClH/c1-9-4-12(9)7-14-6-10-2-3-11-8-15-16-13(11)5-10;/h2-3,5,8-9,12,14H,4,6-7H2,1H3,(H,15,16);1H |
| InChIKey | CDIGOCHCSNCPDR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |