C13H18N4O — CID 120961737
4-[(1H-indazol-6-ylmethylamino)methyl]pyrrolidin-3-ol (PubChem CID 120961737) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[(1H-indazol-6-ylmethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 4-[(1H-indazol-6-ylmethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 120961737 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-[(1H-indazol-6-ylmethylamino)methyl]pyrrolidin-3-ol |
| SMILES | OC1CNCC1CNCc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C13H18N4O/c18-13-8-15-6-11(13)5-14-4-9-1-2-10-7-16-17-12(10)3-9/h1-3,7,11,13-15,18H,4-6,8H2,(H,16,17) |
| InChIKey | SCNCVMOTAPMGJJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |