C14H18ClFN2O2 — CID 115609101
N-[3-(tert-butylamino)-3-oxopropyl]-5-chloro-2-fluorobenzamide (PubChem CID 115609101) has the molecular formula C14H18ClFN2O2 and a molecular weight of 300.76 g/mol. Its IUPAC name is N-[3-(tert-butylamino)-3-oxopropyl]-5-chloro-2-fluorobenzamide.
| Compound Name | N-[3-(tert-butylamino)-3-oxopropyl]-5-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 115609101 |
| Molecular Formula | C14H18ClFN2O2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-[3-(tert-butylamino)-3-oxopropyl]-5-chloro-2-fluorobenzamide |
| SMILES | CC(C)(C)NC(=O)CCNC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H18ClFN2O2/c1-14(2,3)18-12(19)6-7-17-13(20)10-8-9(15)4-5-11(10)16/h4-5,8H,6-7H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | OOPPJKDTSDOLQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |