C15H20ClN3O3S — CID 504521
S-[2-[(3-amino-3-oxopropyl)carbamoyl]-4-chlorophenyl] N-tert-butylcarbamothioate (PubChem CID 504521) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is S-[2-[(3-amino-3-oxopropyl)carbamoyl]-4-chlorophenyl] N-tert-butylcarbamothioate.
| Compound Name | S-[2-[(3-amino-3-oxopropyl)carbamoyl]-4-chlorophenyl] N-tert-butylcarbamothioate |
|---|---|
| PubChem CID | 504521 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | S-[2-[(3-amino-3-oxopropyl)carbamoyl]-4-chlorophenyl] N-tert-butylcarbamothioate |
| SMILES | CC(C)(C)NC(=O)Sc1ccc(Cl)cc1C(=O)NCCC(N)=O |
| InChI | InChI=1S/C15H20ClN3O3S/c1-15(2,3)19-14(22)23-11-5-4-9(16)8-10(11)13(21)18-7-6-12(17)20/h4-5,8H,6-7H2,1-3H3,(H2,17,20)(H,18,21)(H,19,22) |
| InChIKey | WJABQFCCFOTGAP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|