C11H16Cl2N2OS — CID 119384225
N-(2-aminoethyl)-5-chloro-2-ethylsulfanylbenzamide;hydrochloride (PubChem CID 119384225) has the molecular formula C11H16Cl2N2OS and a molecular weight of 295.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-chloro-2-ethylsulfanylbenzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-5-chloro-2-ethylsulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119384225 |
| Molecular Formula | C11H16Cl2N2OS |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N-(2-aminoethyl)-5-chloro-2-ethylsulfanylbenzamide;hydrochloride |
| SMILES | CCSc1ccc(Cl)cc1C(=O)NCCN.Cl |
| InChI | InChI=1S/C11H15ClN2OS.ClH/c1-2-16-10-4-3-8(12)7-9(10)11(15)14-6-5-13;/h3-4,7H,2,5-6,13H2,1H3,(H,14,15);1H |
| InChIKey | CJCPNZZGFADTNR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |