C14H15ClN2OS2 — CID 71974317
5-chloro-2-ethylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 71974317) has the molecular formula C14H15ClN2OS2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 5-chloro-2-ethylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-ethylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 71974317 |
| Molecular Formula | C14H15ClN2OS2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 5-chloro-2-ethylsulfanyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | CCSc1ccc(Cl)cc1C(=O)NCCc1cscn1 |
| InChI | InChI=1S/C14H15ClN2OS2/c1-2-20-13-4-3-10(15)7-12(13)14(18)16-6-5-11-8-19-9-17-11/h3-4,7-9H,2,5-6H2,1H3,(H,16,18) |
| InChIKey | DMVQJBVWBWCCFD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |