C16H23ClN2O2S — CID 97006273
N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]-5-chloro-2-ethylsulfanylbenzamide (PubChem CID 97006273) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]-5-chloro-2-ethylsulfanylbenzamide.
| Compound Name | N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]-5-chloro-2-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 97006273 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl]-5-chloro-2-ethylsulfanylbenzamide |
| SMILES | CCSc1ccc(Cl)cc1C(=O)N[C@@H](C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H23ClN2O2S/c1-6-22-13-8-7-11(17)9-12(13)15(21)18-10(2)14(20)19-16(3,4)5/h7-10H,6H2,1-5H3,(H,18,21)(H,19,20)/t10-/m0/s1 |
| InChIKey | PONIDTBMQAFPHW-JTQLQIEISA-N |
| XLogP | 3.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |