C13H15ClFNO4S — CID 115610875
ethyl 2-[(2-chloro-5-fluorophenyl)sulfonyl-prop-2-enylamino]acetate (PubChem CID 115610875) has the molecular formula C13H15ClFNO4S and a molecular weight of 335.78 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-5-fluorophenyl)sulfonyl-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(2-chloro-5-fluorophenyl)sulfonyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 115610875 |
| Molecular Formula | C13H15ClFNO4S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | ethyl 2-[(2-chloro-5-fluorophenyl)sulfonyl-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H15ClFNO4S/c1-3-7-16(9-13(17)20-4-2)21(18,19)12-8-10(15)5-6-11(12)14/h3,5-6,8H,1,4,7,9H2,2H3 |
| InChIKey | COIMBWKPZWBZOW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|