C13H17ClN2 — CID 115614559
N-(1H-indol-7-ylmethyl)-2-methylcyclopropan-1-amine;hydrochloride (PubChem CID 115614559) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is N-(1H-indol-7-ylmethyl)-2-methylcyclopropan-1-amine;hydrochloride.
| Compound Name | N-(1H-indol-7-ylmethyl)-2-methylcyclopropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115614559 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-(1H-indol-7-ylmethyl)-2-methylcyclopropan-1-amine;hydrochloride |
| SMILES | CC1CC1NCc1cccc2cc[nH]c12.Cl |
| InChI | InChI=1S/C13H16N2.ClH/c1-9-7-12(9)15-8-11-4-2-3-10-5-6-14-13(10)11;/h2-6,9,12,14-15H,7-8H2,1H3;1H |
| InChIKey | CSDKENSVDRIMNQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |