C18H22N4O — CID 128965783
(2S,3S)-N-(1H-indol-7-ylmethyl)-2-(1-methylimidazol-2-yl)oxan-3-amine (PubChem CID 128965783) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S,3S)-N-(1H-indol-7-ylmethyl)-2-(1-methylimidazol-2-yl)oxan-3-amine.
| Compound Name | (2S,3S)-N-(1H-indol-7-ylmethyl)-2-(1-methylimidazol-2-yl)oxan-3-amine |
|---|---|
| PubChem CID | 128965783 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2S,3S)-N-(1H-indol-7-ylmethyl)-2-(1-methylimidazol-2-yl)oxan-3-amine |
| SMILES | Cn1ccnc1[C@H]1OCCC[C@@H]1NCc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C18H22N4O/c1-22-10-9-20-18(22)17-15(6-3-11-23-17)21-12-14-5-2-4-13-7-8-19-16(13)14/h2,4-5,7-10,15,17,19,21H,3,6,11-12H2,1H3/t15-,17-/m0/s1 |
| InChIKey | ZADSWEFDAOMNGG-RDJZCZTQSA-N |
| XLogP | 2.91 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |