C11H16ClN3OS — CID 115615759
3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(thiophen-3-ylmethyl)propan-1-amine;hydrochloride (PubChem CID 115615759) has the molecular formula C11H16ClN3OS and a molecular weight of 273.79 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(thiophen-3-ylmethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(thiophen-3-ylmethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115615759 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(thiophen-3-ylmethyl)propan-1-amine;hydrochloride |
| SMILES | Cc1noc(CCCNCc2ccsc2)n1.Cl |
| InChI | InChI=1S/C11H15N3OS.ClH/c1-9-13-11(15-14-9)3-2-5-12-7-10-4-6-16-8-10;/h4,6,8,12H,2-3,5,7H2,1H3;1H |
| InChIKey | XFPUGXZPWAXMNR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|