C12H16ClN3O — CID 115615868
[3-[(1H-pyrazol-5-ylmethylamino)methyl]phenyl]methanol;hydrochloride (PubChem CID 115615868) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is [3-[(1H-pyrazol-5-ylmethylamino)methyl]phenyl]methanol;hydrochloride.
| Compound Name | [3-[(1H-pyrazol-5-ylmethylamino)methyl]phenyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 115615868 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [3-[(1H-pyrazol-5-ylmethylamino)methyl]phenyl]methanol;hydrochloride |
| SMILES | Cl.OCc1cccc(CNCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C12H15N3O.ClH/c16-9-11-3-1-2-10(6-11)7-13-8-12-4-5-14-15-12;/h1-6,13,16H,7-9H2,(H,14,15);1H |
| InChIKey | CHPXRJWZICDONY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |