C9H11N3O — CID 63001149
1-(furan-3-yl)-N-(1H-pyrazol-5-ylmethyl)methanamine (PubChem CID 63001149) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-(furan-3-yl)-N-(1H-pyrazol-5-ylmethyl)methanamine.
| Compound Name | 1-(furan-3-yl)-N-(1H-pyrazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 63001149 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 1-(furan-3-yl)-N-(1H-pyrazol-5-ylmethyl)methanamine |
| SMILES | c1cc(CNCc2ccoc2)[nH]n1 |
| InChI | InChI=1S/C9H11N3O/c1-3-11-12-9(1)6-10-5-8-2-4-13-7-8/h1-4,7,10H,5-6H2,(H,11,12) |
| InChIKey | OTYLUKUIPVBXET-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |