C13H21ClN2S — CID 115616309
1-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;hydrochloride (PubChem CID 115616309) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is 1-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;hydrochloride.
| Compound Name | 1-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 115616309 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;hydrochloride |
| SMILES | C=CCN1CCC(NCc2cccs2)CC1.Cl |
| InChI | InChI=1S/C13H20N2S.ClH/c1-2-7-15-8-5-12(6-9-15)14-11-13-4-3-10-16-13;/h2-4,10,12,14H,1,5-9,11H2;1H |
| InChIKey | LSJIKKADFNRTAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|