C12H20N4 — CID 115616302
N-(1H-imidazol-5-ylmethyl)-1-prop-2-enylpiperidin-4-amine (PubChem CID 115616302) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-1-prop-2-enylpiperidin-4-amine.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-1-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 115616302 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-1-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN1CCC(NCc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C12H20N4/c1-2-5-16-6-3-11(4-7-16)14-9-12-8-13-10-15-12/h2,8,10-11,14H,1,3-7,9H2,(H,13,15) |
| InChIKey | IQRFAFFMYWBFOJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|