C22H29N3O2 — CID 119124188
N-[[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]methyl]-1-prop-2-enylpiperidin-4-amine (PubChem CID 119124188) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]methyl]-1-prop-2-enylpiperidin-4-amine.
| Compound Name | N-[[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]methyl]-1-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 119124188 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-[[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]methyl]-1-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN1CCC(NCc2ccc(OC)c(OCc3cccnc3)c2)CC1 |
| InChI | InChI=1S/C22H29N3O2/c1-3-11-25-12-8-20(9-13-25)24-16-18-6-7-21(26-2)22(14-18)27-17-19-5-4-10-23-15-19/h3-7,10,14-15,20,24H,1,8-9,11-13,16-17H2,2H3 |
| InChIKey | PHNBIFCGAPIBOU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|