C23H29FN2O2 — CID 119124222
N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-prop-2-enylpiperidin-4-amine (PubChem CID 119124222) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-prop-2-enylpiperidin-4-amine.
| Compound Name | N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 119124222 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN1CCC(NCc2ccc(OCc3ccc(F)cc3)c(OC)c2)CC1 |
| InChI | InChI=1S/C23H29FN2O2/c1-3-12-26-13-10-21(11-14-26)25-16-19-6-9-22(23(15-19)27-2)28-17-18-4-7-20(24)8-5-18/h3-9,15,21,25H,1,10-14,16-17H2,2H3 |
| InChIKey | WNASABKFOOHJOO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|