C11H18ClN3O — CID 115616397
N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]oxan-3-amine (PubChem CID 115616397) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]oxan-3-amine.
| Compound Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 115616397 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]oxan-3-amine |
| SMILES | Cc1nn(C)c(Cl)c1CNC1CCCOC1 |
| InChI | InChI=1S/C11H18ClN3O/c1-8-10(11(12)15(2)14-8)6-13-9-4-3-5-16-7-9/h9,13H,3-7H2,1-2H3 |
| InChIKey | SNGFUKCCRJQAKW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |