C10H10BrF2N — CID 115618237
2-bromo-N-[(2,3-difluorophenyl)methyl]prop-2-en-1-amine (PubChem CID 115618237) has the molecular formula C10H10BrF2N and a molecular weight of 262.10 g/mol. Its IUPAC name is 2-bromo-N-[(2,3-difluorophenyl)methyl]prop-2-en-1-amine.
| Compound Name | 2-bromo-N-[(2,3-difluorophenyl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115618237 |
| Molecular Formula | C10H10BrF2N |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 2-bromo-N-[(2,3-difluorophenyl)methyl]prop-2-en-1-amine |
| SMILES | C=C(Br)CNCc1cccc(F)c1F |
| InChI | InChI=1S/C10H10BrF2N/c1-7(11)5-14-6-8-3-2-4-9(12)10(8)13/h2-4,14H,1,5-6H2 |
| InChIKey | OVSWFPASDXSDHO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |