C26H27N7O2 — CID 11561848
2-(3-acetamidoanilino)-N-[2-(methylamino)ethyl]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 11561848) has the molecular formula C26H27N7O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-N-[2-(methylamino)ethyl]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 2-(3-acetamidoanilino)-N-[2-(methylamino)ethyl]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 11561848 |
| Molecular Formula | C26H27N7O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2-(3-acetamidoanilino)-N-[2-(methylamino)ethyl]-6-(2-methylphenyl)pyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CNCCNC(=O)c1nc2nc(Nc3cccc(NC(C)=O)c3)ncc2cc1-c1ccccc1C |
| InChI | InChI=1S/C26H27N7O2/c1-16-7-4-5-10-21(16)22-13-18-15-29-26(31-20-9-6-8-19(14-20)30-17(2)34)33-24(18)32-23(22)25(35)28-12-11-27-3/h4-10,13-15,27H,11-12H2,1-3H3,(H,28,35)(H,30,34)(H,29,31,32,33) |
| InChIKey | QUMGKQBBESLHQJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|