C10H21N3O2 — CID 115618628
2-[diethylcarbamoyl(methyl)amino]-N-ethylacetamide (PubChem CID 115618628) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[diethylcarbamoyl(methyl)amino]-N-ethylacetamide.
| Compound Name | 2-[diethylcarbamoyl(methyl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 115618628 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-[diethylcarbamoyl(methyl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)C(=O)N(CC)CC |
| InChI | InChI=1S/C10H21N3O2/c1-5-11-9(14)8-12(4)10(15)13(6-2)7-3/h5-8H2,1-4H3,(H,11,14) |
| InChIKey | BSSOUPRAVABPDO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |