C9H17N3O3 — CID 143168643
2-[[2-[acetyl(methyl)amino]acetyl]amino]-N-ethylacetamide (PubChem CID 143168643) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[[2-[acetyl(methyl)amino]acetyl]amino]-N-ethylacetamide.
| Compound Name | 2-[[2-[acetyl(methyl)amino]acetyl]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 143168643 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-[[2-[acetyl(methyl)amino]acetyl]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNC(=O)CN(C)C(C)=O |
| InChI | InChI=1S/C9H17N3O3/c1-4-10-8(14)5-11-9(15)6-12(3)7(2)13/h4-6H2,1-3H3,(H,10,14)(H,11,15) |
| InChIKey | RYJSIUXQSRTYAZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |