C17H21N3O — CID 115621226
(E)-3-(2,4-dimethylphenyl)-N-(5-propyl-1H-pyrazol-3-yl)prop-2-enamide (PubChem CID 115621226) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-(5-propyl-1H-pyrazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-(5-propyl-1H-pyrazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 115621226 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-(5-propyl-1H-pyrazol-3-yl)prop-2-enamide |
| SMILES | CCCc1cc(NC(=O)/C=C/c2ccc(C)cc2C)n[nH]1 |
| InChI | InChI=1S/C17H21N3O/c1-4-5-15-11-16(20-19-15)18-17(21)9-8-14-7-6-12(2)10-13(14)3/h6-11H,4-5H2,1-3H3,(H2,18,19,20,21)/b9-8+ |
| InChIKey | FBBQPICMABEMAS-CMDGGOBGSA-N |
| XLogP | 3.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|