C18H23NO — CID 115621741
3-[[(2-methyl-4-phenylbutan-2-yl)amino]methyl]phenol (PubChem CID 115621741) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-[[(2-methyl-4-phenylbutan-2-yl)amino]methyl]phenol.
| Compound Name | 3-[[(2-methyl-4-phenylbutan-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115621741 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3-[[(2-methyl-4-phenylbutan-2-yl)amino]methyl]phenol |
| SMILES | CC(C)(CCc1ccccc1)NCc1cccc(O)c1 |
| InChI | InChI=1S/C18H23NO/c1-18(2,12-11-15-7-4-3-5-8-15)19-14-16-9-6-10-17(20)13-16/h3-10,13,19-20H,11-12,14H2,1-2H3 |
| InChIKey | ARXLZCSYGDTFBN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |