C24H35N5O6 — CID 11562221
(2S)-2-[[1-[(2S)-2-acetamido-6-aminohexanoyl]-4-phenylpiperidine-4-carbonyl]amino]-4-amino-4-oxobutanoic acid (PubChem CID 11562221) has the molecular formula C24H35N5O6 and a molecular weight of 489.57 g/mol. Its IUPAC name is (2S)-2-[[1-[(2S)-2-acetamido-6-aminohexanoyl]-4-phenylpiperidine-4-carbonyl]amino]-4-amino-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[1-[(2S)-2-acetamido-6-aminohexanoyl]-4-phenylpiperidine-4-carbonyl]amino]-4-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11562221 |
| Molecular Formula | C24H35N5O6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | (2S)-2-[[1-[(2S)-2-acetamido-6-aminohexanoyl]-4-phenylpiperidine-4-carbonyl]amino]-4-amino-4-oxobutanoic acid |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N1CCC(C(=O)N[C@@H](CC(N)=O)C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H35N5O6/c1-16(30)27-18(9-5-6-12-25)21(32)29-13-10-24(11-14-29,17-7-3-2-4-8-17)23(35)28-19(22(33)34)15-20(26)31/h2-4,7-8,18-19H,5-6,9-15,25H2,1H3,(H2,26,31)(H,27,30)(H,28,35)(H,33,34)/t18-,19-/m0/s1 |
| InChIKey | PILJQBDDGHBRDO-OALUTQOASA-N |
| XLogP | -0.37 |
| TPSA | 184.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|