C12H15ClN2OS — CID 115625144
2-chloro-N-(thian-4-ylmethyl)pyridine-4-carboxamide (PubChem CID 115625144) has the molecular formula C12H15ClN2OS and a molecular weight of 270.78 g/mol. Its IUPAC name is 2-chloro-N-(thian-4-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(thian-4-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115625144 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-chloro-N-(thian-4-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCC1CCSCC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2OS/c13-11-7-10(1-4-14-11)12(16)15-8-9-2-5-17-6-3-9/h1,4,7,9H,2-3,5-6,8H2,(H,15,16) |
| InChIKey | NQHKEMHSIYFSRE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|