C13H16N2O4 — CID 115628088
3-methoxy-4-nitro-N-[(E)-pent-3-enyl]benzamide (PubChem CID 115628088) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-methoxy-4-nitro-N-[(E)-pent-3-enyl]benzamide.
| Compound Name | 3-methoxy-4-nitro-N-[(E)-pent-3-enyl]benzamide |
|---|---|
| PubChem CID | 115628088 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-methoxy-4-nitro-N-[(E)-pent-3-enyl]benzamide |
| SMILES | C/C=C/CCNC(=O)c1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-3-4-5-8-14-13(16)10-6-7-11(15(17)18)12(9-10)19-2/h3-4,6-7,9H,5,8H2,1-2H3,(H,14,16)/b4-3+ |
| InChIKey | VUQHTMLDAJLWSV-ONEGZZNKSA-N |
| XLogP | 2.30 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|