C31H38O4S2 — CID 11562892
(2S)-2-[(1S,2S,3R)-4,4-bis(ethylsulfanyl)-1,2,3-tris(phenylmethoxy)butyl]oxirane (PubChem CID 11562892) has the molecular formula C31H38O4S2 and a molecular weight of 538.78 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,3R)-4,4-bis(ethylsulfanyl)-1,2,3-tris(phenylmethoxy)butyl]oxirane.
| Compound Name | (2S)-2-[(1S,2S,3R)-4,4-bis(ethylsulfanyl)-1,2,3-tris(phenylmethoxy)butyl]oxirane |
|---|---|
| PubChem CID | 11562892 |
| Molecular Formula | C31H38O4S2 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (2S)-2-[(1S,2S,3R)-4,4-bis(ethylsulfanyl)-1,2,3-tris(phenylmethoxy)butyl]oxirane |
| SMILES | CCSC(SCC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]1CO1 |
| InChI | InChI=1S/C31H38O4S2/c1-3-36-31(37-4-2)30(35-22-26-18-12-7-13-19-26)29(34-21-25-16-10-6-11-17-25)28(27-23-32-27)33-20-24-14-8-5-9-15-24/h5-19,27-31H,3-4,20-23H2,1-2H3/t27-,28-,29-,30+/m0/s1 |
| InChIKey | NYEVQRJIEAPUOK-GCXHJFECSA-N |
| XLogP | 6.97 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|