C12H15FN2O — CID 115629205
1-(2-fluorophenyl)-3-[(E)-pent-3-enyl]urea (PubChem CID 115629205) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(E)-pent-3-enyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[(E)-pent-3-enyl]urea |
|---|---|
| PubChem CID | 115629205 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(E)-pent-3-enyl]urea |
| SMILES | C/C=C/CCNC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H15FN2O/c1-2-3-6-9-14-12(16)15-11-8-5-4-7-10(11)13/h2-5,7-8H,6,9H2,1H3,(H2,14,15,16)/b3-2+ |
| InChIKey | SEJXCNRWGUHOKS-NSCUHMNNSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|