C9H15F3N2O — CID 115629627
3-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)urea (PubChem CID 115629627) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is 3-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115629627 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-cyclopentyl-1-methyl-1-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(CC(F)(F)F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C9H15F3N2O/c1-14(6-9(10,11)12)8(15)13-7-4-2-3-5-7/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | JDCGRZDLOULWQY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |