C36H32O6 — CID 11563113
1,3,6-tris[(4-hydroxyphenyl)methyl]-4-methoxy-9,10-dihydrophenanthrene-2,7-diol (PubChem CID 11563113) has the molecular formula C36H32O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is 1,3,6-tris[(4-hydroxyphenyl)methyl]-4-methoxy-9,10-dihydrophenanthrene-2,7-diol.
| Compound Name | 1,3,6-tris[(4-hydroxyphenyl)methyl]-4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 11563113 |
| Molecular Formula | C36H32O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 1,3,6-tris[(4-hydroxyphenyl)methyl]-4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| SMILES | COc1c(Cc2ccc(O)cc2)c(O)c(Cc2ccc(O)cc2)c2c1-c1cc(Cc3ccc(O)cc3)c(O)cc1CC2 |
| InChI | InChI=1S/C36H32O6/c1-42-36-32(18-23-6-13-28(39)14-7-23)35(41)31(17-22-4-11-27(38)12-5-22)29-15-8-24-20-33(40)25(19-30(24)34(29)36)16-21-2-9-26(37)10-3-21/h2-7,9-14,19-20,37-41H,8,15-18H2,1H3 |
| InChIKey | JDKDUOZXOSMKTI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |