C11H21N3OS — CID 115632431
N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2-methylsulfinylethanamine (PubChem CID 115632431) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 115632431 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1cn[nH]c1C(C)(C)C |
| InChI | InChI=1S/C11H21N3OS/c1-11(2,3)10-9(8-13-14-10)7-12-5-6-16(4)15/h8,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | IDCZYABWRAMQRJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|