About 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide
2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 115635315) has the molecular formula C7H8N4OS
and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide.
Analyze 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide?
The IUPAC name of 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide (CID 115635315) is 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide.
What is the SMILES notation for 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide?
The canonical SMILES for 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide is Cc1nnc(NC(=O)C(C)C#N)s1.
What is the InChIKey of 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide?
The InChIKey is XXPTZLMUMBNXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c1-4(3-8)6(12)9-7-11-10-5(2)13-7/h4H,1-2H3,(H,9,11,12).
What are the key properties of 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide?
2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide has a molecular weight of 196.23 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide is sourced from PubChem (CID 115635315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).