C8H11ClN2O2 — CID 115636687
N-(2-chloroprop-2-enyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 115636687) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2-chloroprop-2-enyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 115636687 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | C=C(Cl)CNC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C8H11ClN2O2/c1-5(9)3-11-8(13)6-2-7(12)10-4-6/h6H,1-4H2,(H,10,12)(H,11,13) |
| InChIKey | JQJOEMKHFFWURG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |