C44H43NO4S — CID 11563802
(4R)-3-[(E,3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11563802) has the molecular formula C44H43NO4S and a molecular weight of 681.90 g/mol. Its IUPAC name is (4R)-3-[(E,3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(E,3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11563802 |
| Molecular Formula | C44H43NO4S |
| Molecular Weight | 681.90 g/mol |
| Exact Mass | 681.29 |
| IUPAC Name | (4R)-3-[(E,3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1N(C(=O)C[C@H](O)/C=C/CCSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H43NO4S/c1-33(2)41-43(34-20-8-3-9-21-34,35-22-10-4-11-23-35)49-42(48)45(41)40(47)32-39(46)30-18-19-31-50-44(36-24-12-5-13-25-36,37-26-14-6-15-27-37)38-28-16-7-17-29-38/h3-18,20-30,33,39,41,46H,19,31-32H2,1-2H3/b30-18+/t39-,41-/m1/s1 |
| InChIKey | HHUVAXKXRWUQOO-IRRHBCLQSA-N |
| XLogP | 9.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.90 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|