C24H26FNO4 — CID 139309209
(4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 139309209) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is (4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139309209 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (4R)-3-[(2R,3R)-2-fluoro-3-hydroxy-2-methylpent-4-enoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O)[C@@](C)(F)C(=O)N1C(=O)OC(c2ccccc2)(c2ccccc2)[C@H]1C(C)C |
| InChI | InChI=1S/C24H26FNO4/c1-5-19(27)23(4,25)21(28)26-20(16(2)3)24(30-22(26)29,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h5-16,19-20,27H,1H2,2-4H3/t19-,20-,23-/m1/s1 |
| InChIKey | LEUPNRIKKPSPQZ-TXTKFYIRSA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|