C15H21N3OS — CID 115638357
N-(3-cyanophenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]acetamide (PubChem CID 115638357) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 115638357 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-(3-cyanophenyl)-2-[methyl(4-methylsulfanylbutan-2-yl)amino]acetamide |
| SMILES | CSCCC(C)N(C)CC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H21N3OS/c1-12(7-8-20-3)18(2)11-15(19)17-14-6-4-5-13(9-14)10-16/h4-6,9,12H,7-8,11H2,1-3H3,(H,17,19) |
| InChIKey | QROXOFKNRGTYQN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |