C16H23NOS — CID 115641639
N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]thian-4-amine (PubChem CID 115641639) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]thian-4-amine.
| Compound Name | N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 115641639 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]thian-4-amine |
| SMILES | CC1(C)Cc2cccc(CNC3CCSCC3)c2O1 |
| InChI | InChI=1S/C16H23NOS/c1-16(2)10-12-4-3-5-13(15(12)18-16)11-17-14-6-8-19-9-7-14/h3-5,14,17H,6-11H2,1-2H3 |
| InChIKey | YEAPBEZPWJZEKE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |