C12H15N3 — CID 115644105
2-(2,4-dimethylpyrrolidin-1-yl)pyridine-3-carbonitrile (PubChem CID 115644105) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(2,4-dimethylpyrrolidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(2,4-dimethylpyrrolidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 115644105 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-(2,4-dimethylpyrrolidin-1-yl)pyridine-3-carbonitrile |
| SMILES | CC1CC(C)N(c2ncccc2C#N)C1 |
| InChI | InChI=1S/C12H15N3/c1-9-6-10(2)15(8-9)12-11(7-13)4-3-5-14-12/h3-5,9-10H,6,8H2,1-2H3 |
| InChIKey | NWEICHVXROWAMC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |