C16H23NO2 — CID 115644591
3-[(2-ethyl-1-benzofuran-3-yl)methylamino]-2-methylbutan-1-ol (PubChem CID 115644591) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 3-[(2-ethyl-1-benzofuran-3-yl)methylamino]-2-methylbutan-1-ol.
| Compound Name | 3-[(2-ethyl-1-benzofuran-3-yl)methylamino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 115644591 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-[(2-ethyl-1-benzofuran-3-yl)methylamino]-2-methylbutan-1-ol |
| SMILES | CCc1oc2ccccc2c1CNC(C)C(C)CO |
| InChI | InChI=1S/C16H23NO2/c1-4-15-14(9-17-12(3)11(2)10-18)13-7-5-6-8-16(13)19-15/h5-8,11-12,17-18H,4,9-10H2,1-3H3 |
| InChIKey | PRBZHDAEKUBKFX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |