C10H12O3 — CID 11564560
3,8-dimethyl-5,8-dihydro-2H-furo[3,4-b]oxepin-6-one (PubChem CID 11564560) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 3,8-dimethyl-5,8-dihydro-2H-furo[3,4-b]oxepin-6-one.
| Compound Name | 3,8-dimethyl-5,8-dihydro-2H-furo[3,4-b]oxepin-6-one |
|---|---|
| PubChem CID | 11564560 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3,8-dimethyl-5,8-dihydro-2H-furo[3,4-b]oxepin-6-one |
| SMILES | CC1=CCC2=C(OC1)C(C)OC2=O |
| InChI | InChI=1S/C10H12O3/c1-6-3-4-8-9(12-5-6)7(2)13-10(8)11/h3,7H,4-5H2,1-2H3 |
| InChIKey | GMHRGCMRMQZRQS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|