About (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone
(4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone (PubChem CID 115646256) has the molecular formula C16H15FN2OS
and a molecular weight of 302.37 g/mol. Its IUPAC name is (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone.
Molecular Properties
| Compound Name | (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone |
| PubChem CID | 115646256 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1F)N1CCc2sccc2C1C1CC1 |
| InChI | InChI=1S/C16H15FN2OS/c17-13-9-18-6-3-11(13)16(20)19-7-4-14-12(5-8-21-14)15(19)10-1-2-10/h3,5-6,8-10,15H,1-2,4,7H2 |
| InChIKey | LJDCWBUGZWPCPB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone?
The IUPAC name of (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone (CID 115646256) is (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone.
What is the SMILES notation for (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone?
The canonical SMILES for (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone is O=C(c1ccncc1F)N1CCc2sccc2C1C1CC1.
What is the InChIKey of (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone?
The InChIKey is LJDCWBUGZWPCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2OS/c17-13-9-18-6-3-11(13)16(20)19-7-4-14-12(5-8-21-14)15(19)10-1-2-10/h3,5-6,8-10,15H,1-2,4,7H2.
What are the key properties of (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone?
(4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone has a molecular weight of 302.37 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(3-fluoro-4-pyridinyl)methanone is sourced from PubChem (CID 115646256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).