C15H23NO2S — CID 115646570
N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]pent-4-en-2-amine (PubChem CID 115646570) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]pent-4-en-2-amine.
| Compound Name | N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 115646570 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]pent-4-en-2-amine |
| SMILES | C=CCC(C)NCc1cc(OC)c(OC)cc1SC |
| InChI | InChI=1S/C15H23NO2S/c1-6-7-11(2)16-10-12-8-13(17-3)14(18-4)9-15(12)19-5/h6,8-9,11,16H,1,7,10H2,2-5H3 |
| InChIKey | GVHBQNFRRJNRLE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|