C9H12N2O3S — CID 11564854
1-hydroxy-N-(3-hydroxypropyl)-2-sulfanylidenepyridine-3-carboxamide (PubChem CID 11564854) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 1-hydroxy-N-(3-hydroxypropyl)-2-sulfanylidenepyridine-3-carboxamide.
| Compound Name | 1-hydroxy-N-(3-hydroxypropyl)-2-sulfanylidenepyridine-3-carboxamide |
|---|---|
| PubChem CID | 11564854 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-hydroxy-N-(3-hydroxypropyl)-2-sulfanylidenepyridine-3-carboxamide |
| SMILES | O=C(NCCCO)c1cccn(O)c1=S |
| InChI | InChI=1S/C9H12N2O3S/c12-6-2-4-10-8(13)7-3-1-5-11(14)9(7)15/h1,3,5,12,14H,2,4,6H2,(H,10,13) |
| InChIKey | TXDLCWCRFZDJLZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|