C10H14N2O3S — CID 88537359
N,N-bis(2-hydroxyethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 88537359) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88537359 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(c1ccc[nH]c1=S)N(CCO)CCO |
| InChI | InChI=1S/C10H14N2O3S/c13-6-4-12(5-7-14)10(15)8-2-1-3-11-9(8)16/h1-3,13-14H,4-7H2,(H,11,16) |
| InChIKey | AMBCBMNNULFSBK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|