C8H8N2O3S — CID 129245196
2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]acetic acid (PubChem CID 129245196) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 129245196 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-[(2-sulfanylidene-1H-pyridine-3-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H8N2O3S/c11-6(12)4-10-7(13)5-2-1-3-9-8(5)14/h1-3H,4H2,(H,9,14)(H,10,13)(H,11,12) |
| InChIKey | LJJOEVWTSMQPDV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|