C9H11N3O2S — CID 88873602
N-(3-amino-3-oxopropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 88873602) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88873602 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)CCNC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C9H11N3O2S/c10-7(13)3-5-11-8(14)6-2-1-4-12-9(6)15/h1-2,4H,3,5H2,(H2,10,13)(H,11,14)(H,12,15) |
| InChIKey | VGFUTTBXCJIOLG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|